C22H44N4 — CID 23451962
2,2,6,6-tetramethyl-4-[2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-1-yl]piperidine (PubChem CID 23451962) has the molecular formula C22H44N4 and a molecular weight of 364.62 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-1-yl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-1-yl]piperidine |
|---|---|
| PubChem CID | 23451962 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)imidazolidin-1-yl]piperidine |
| SMILES | CC1N(C2CC(C)(C)NC(C)(C)C2)CCN1C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H44N4/c1-16-25(17-12-19(2,3)23-20(4,5)13-17)10-11-26(16)18-14-21(6,7)24-22(8,9)15-18/h16-18,23-24H,10-15H2,1-9H3 |
| InChIKey | PZJIBEOUNKSGOX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |