C19H18N2O2S — CID 2345204
2-[(4-Methoxyphenyl)carbonyl]-5H,6H,7H,8H-thieno[2,3-b]quinolin-3-amine (PubChem CID 2345204) has the molecular formula C19H18N2O2S and a molecular weight of 338.40 g/mol. Its IUPAC name is (3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)-(4-methoxyphenyl)methanone.
| Compound Name | 2-[(4-Methoxyphenyl)carbonyl]-5H,6H,7H,8H-thieno[2,3-b]quinolin-3-amine |
|---|---|
| PubChem CID | 2345204 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)-(4-methoxyphenyl)methanone |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(C3=C(S2)N=C4CCCCC4=C3)N |
| InChI | InChI=1S/C19H18N2O2S/c1-23-13-8-6-11(7-9-13)17(22)18-16(20)14-10-12-4-2-3-5-15(12)21-19(14)24-18/h6-10H,2-5,20H2,1H3 |
| InChIKey | CDZCVVLUUYQTJL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 466 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |