About N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide
N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide (PubChem CID 23452232) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide.
Molecular Properties
| Compound Name | N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide |
| PubChem CID | 23452232 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide |
| SMILES | C=C(C(=O)N(CC)CC)C(C)C(=O)NCCCC |
| InChI | InChI=1S/C14H26N2O2/c1-6-9-10-15-13(17)11(4)12(5)14(18)16(7-2)8-3/h11H,5-10H2,1-4H3,(H,15,17) |
| InChIKey | CZSYWOVSHVXCRF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide?
The IUPAC name of N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide (CID 23452232) is N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide.
What is the SMILES notation for N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide?
The canonical SMILES for N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide is C=C(C(=O)N(CC)CC)C(C)C(=O)NCCCC.
What is the InChIKey of N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide?
The InChIKey is CZSYWOVSHVXCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2/c1-6-9-10-15-13(17)11(4)12(5)14(18)16(7-2)8-3/h11H,5-10H2,1-4H3,(H,15,17).
What are the key properties of N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide?
N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide has a molecular weight of 254.37 g/mol, XLogP of 1.96, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N',N'-diethyl-2-methyl-3-methylidenebutanediamide is sourced from PubChem (CID 23452232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).