About 3-cyano-N,2-dimethylbut-3-enamide
3-cyano-N,2-dimethylbut-3-enamide (PubChem CID 23452261) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-cyano-N,2-dimethylbut-3-enamide.
Molecular Properties
| Compound Name | 3-cyano-N,2-dimethylbut-3-enamide |
| PubChem CID | 23452261 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-cyano-N,2-dimethylbut-3-enamide |
| SMILES | C=C(C#N)C(C)C(=O)NC |
| InChI | InChI=1S/C7H10N2O/c1-5(4-8)6(2)7(10)9-3/h6H,1H2,2-3H3,(H,9,10) |
| InChIKey | SOTHNXRHNDJLOD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-N,2-dimethylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N,2-dimethylbut-3-enamide?
The IUPAC name of 3-cyano-N,2-dimethylbut-3-enamide (CID 23452261) is 3-cyano-N,2-dimethylbut-3-enamide.
What is the SMILES notation for 3-cyano-N,2-dimethylbut-3-enamide?
The canonical SMILES for 3-cyano-N,2-dimethylbut-3-enamide is C=C(C#N)C(C)C(=O)NC.
What is the InChIKey of 3-cyano-N,2-dimethylbut-3-enamide?
The InChIKey is SOTHNXRHNDJLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-5(4-8)6(2)7(10)9-3/h6H,1H2,2-3H3,(H,9,10).
What are the key properties of 3-cyano-N,2-dimethylbut-3-enamide?
3-cyano-N,2-dimethylbut-3-enamide has a molecular weight of 138.17 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N,2-dimethylbut-3-enamide is sourced from PubChem (CID 23452261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).