About 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide
2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide (PubChem CID 23452408) has the molecular formula C17H31NO5
and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide |
| PubChem CID | 23452408 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide |
| SMILES | C=CCOCC1COCC(COCC(=O)N(CCC)CCC)O1 |
| InChI | InChI=1S/C17H31NO5/c1-4-7-18(8-5-2)17(19)14-22-13-16-12-21-11-15(23-16)10-20-9-6-3/h6,15-16H,3-5,7-14H2,1-2H3 |
| InChIKey | NPKSUYBIMNHFGZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide?
The IUPAC name of 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide (CID 23452408) is 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide.
What is the SMILES notation for 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide?
The canonical SMILES for 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide is C=CCOCC1COCC(COCC(=O)N(CCC)CCC)O1.
What is the InChIKey of 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide?
The InChIKey is NPKSUYBIMNHFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO5/c1-4-7-18(8-5-2)17(19)14-22-13-16-12-21-11-15(23-16)10-20-9-6-3/h6,15-16H,3-5,7-14H2,1-2H3.
What are the key properties of 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide?
2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide has a molecular weight of 329.44 g/mol, XLogP of 1.64, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(prop-2-enoxymethyl)-1,4-dioxan-2-yl]methoxy]-N,N-dipropylacetamide is sourced from PubChem (CID 23452408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).