C12H11ClN2 — CID 23452499
(2Z)-2-(4-chlorophenyl)-2-pyrrolidin-2-ylideneacetonitrile (PubChem CID 23452499) has the molecular formula C12H11ClN2 and a molecular weight of 218.69 g/mol. Its IUPAC name is (2Z)-2-(4-chlorophenyl)-2-pyrrolidin-2-ylideneacetonitrile.
| Compound Name | (2Z)-2-(4-chlorophenyl)-2-pyrrolidin-2-ylideneacetonitrile |
|---|---|
| PubChem CID | 23452499 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (2Z)-2-(4-chlorophenyl)-2-pyrrolidin-2-ylideneacetonitrile |
| SMILES | N#C/C(=C1/CCCN1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN2/c13-10-5-3-9(4-6-10)11(8-14)12-2-1-7-15-12/h3-6,15H,1-2,7H2/b12-11+ |
| InChIKey | LIAISSHAWLDEEF-VAWYXSNFSA-N |
| XLogP | 2.96 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|