About 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride
5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride (PubChem CID 23453103) has the molecular formula C10H8Cl2O2
and a molecular weight of 231.08 g/mol. Its IUPAC name is 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride |
| PubChem CID | 23453103 |
| Molecular Formula | C10H8Cl2O2 |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride |
| SMILES | CC1Oc2ccc(Cl)cc2C1C(=O)Cl |
| InChI | InChI=1S/C10H8Cl2O2/c1-5-9(10(12)13)7-4-6(11)2-3-8(7)14-5/h2-5,9H,1H3 |
| InChIKey | FQJWBRKNIHIYIP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride?
The IUPAC name of 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride (CID 23453103) is 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride.
What is the SMILES notation for 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride?
The canonical SMILES for 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride is CC1Oc2ccc(Cl)cc2C1C(=O)Cl.
What is the InChIKey of 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride?
The InChIKey is FQJWBRKNIHIYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2O2/c1-5-9(10(12)13)7-4-6(11)2-3-8(7)14-5/h2-5,9H,1H3.
What are the key properties of 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride?
5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride has a molecular weight of 231.08 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-2,3-dihydro-1-benzofuran-3-carbonyl chloride is sourced from PubChem (CID 23453103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).