C10H13N2O3P — CID 23453414
1-(1-methylbenzimidazol-2-yl)ethylphosphonic acid (PubChem CID 23453414) has the molecular formula C10H13N2O3P and a molecular weight of 240.20 g/mol. Its IUPAC name is 1-(1-methylbenzimidazol-2-yl)ethylphosphonic acid.
| Compound Name | 1-(1-methylbenzimidazol-2-yl)ethylphosphonic acid |
|---|---|
| PubChem CID | 23453414 |
| Molecular Formula | C10H13N2O3P |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-(1-methylbenzimidazol-2-yl)ethylphosphonic acid |
| SMILES | CC(c1nc2ccccc2n1C)P(=O)(O)O |
| InChI | InChI=1S/C10H13N2O3P/c1-7(16(13,14)15)10-11-8-5-3-4-6-9(8)12(10)2/h3-7H,1-2H3,(H2,13,14,15) |
| InChIKey | FSUHRKCREVPWKT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|