C17H19N5O — CID 23453904
(4-hydrazinyl-5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl)-phenylmethanone (PubChem CID 23453904) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (4-hydrazinyl-5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl)-phenylmethanone.
| Compound Name | (4-hydrazinyl-5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl)-phenylmethanone |
|---|---|
| PubChem CID | 23453904 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (4-hydrazinyl-5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl)-phenylmethanone |
| SMILES | NNc1cc2c(nn1)CC1CCCC2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19N5O/c18-19-16-10-13-14(20-21-16)9-12-7-4-8-15(13)22(12)17(23)11-5-2-1-3-6-11/h1-3,5-6,10,12,15H,4,7-9,18H2,(H,19,21) |
| InChIKey | FEOMIZZVZSSEMZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|