C10H13N3O — CID 23453906
5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,6-dien-4-one (PubChem CID 23453906) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,6-dien-4-one.
| Compound Name | 5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,6-dien-4-one |
|---|---|
| PubChem CID | 23453906 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5,6,13-triazatricyclo[7.3.1.02,7]trideca-2,6-dien-4-one |
| SMILES | O=c1cc2c(n[nH]1)CC1CCCC2N1 |
| InChI | InChI=1S/C10H13N3O/c14-10-5-7-8-3-1-2-6(11-8)4-9(7)12-13-10/h5-6,8,11H,1-4H2,(H,13,14) |
| InChIKey | AVDDCAPRTGZJFA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |