C27H32N5OS+ — CID 2345397
dimethyl-[2-[[2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]ethyl]azanium (PubChem CID 2345397) has the molecular formula C27H32N5OS+ and a molecular weight of 474.65 g/mol. Its IUPAC name is dimethyl-[2-[[2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 2345397 |
| Molecular Formula | C27H32N5OS+ |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | dimethyl-[2-[[2-(phenoxymethyl)-6-phenyl-1,3,4-triazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carbothioyl]amino]ethyl]azanium |
| SMILES | C[NH+](C)CCNC(=S)c1c(-c2ccccc2)c2c3n(c(COc4ccccc4)nn13)CCCC2 |
| InChI | InChI=1S/C27H31N5OS/c1-30(2)18-16-28-26(34)25-24(20-11-5-3-6-12-20)22-15-9-10-17-31-23(29-32(25)27(22)31)19-33-21-13-7-4-8-14-21/h3-8,11-14H,9-10,15-19H2,1-2H3,(H,28,34)/p+1 |
| InChIKey | MRMQVTXYZHPKGM-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 47.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|