C18H16O2 — CID 23454169
1,2,4,7-tetramethylanthracene-9,10-dione (PubChem CID 23454169) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1,2,4,7-tetramethylanthracene-9,10-dione.
| Compound Name | 1,2,4,7-tetramethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 23454169 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1,2,4,7-tetramethylanthracene-9,10-dione |
| SMILES | Cc1ccc2c(c1)C(=O)c1c(C)c(C)cc(C)c1C2=O |
| InChI | InChI=1S/C18H16O2/c1-9-5-6-13-14(7-9)18(20)16-12(4)10(2)8-11(3)15(16)17(13)19/h5-8H,1-4H3 |
| InChIKey | AWFOHSBOBYAJCH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|