About 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol
2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol (PubChem CID 23454249) has the molecular formula C34H36O4
and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol.
Molecular Properties
| Compound Name | 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol |
| PubChem CID | 23454249 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol |
| SMILES | Cc1cc(C2(c3ccc(O)c(C)c3)CCC(c3ccc(O)c(C)c3)(c3ccc(O)c(C)c3)CC2)ccc1O |
| InChI | InChI=1S/C34H36O4/c1-21-17-25(5-9-29(21)35)33(26-6-10-30(36)22(2)18-26)13-15-34(16-14-33,27-7-11-31(37)23(3)19-27)28-8-12-32(38)24(4)20-28/h5-12,17-20,35-38H,13-16H2,1-4H3 |
| InChIKey | MTNNDVOSVPWQHW-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol?
The IUPAC name of 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol (CID 23454249) is 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol.
What is the SMILES notation for 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol?
The canonical SMILES for 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol is Cc1cc(C2(c3ccc(O)c(C)c3)CCC(c3ccc(O)c(C)c3)(c3ccc(O)c(C)c3)CC2)ccc1O.
What is the InChIKey of 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol?
The InChIKey is MTNNDVOSVPWQHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H36O4/c1-21-17-25(5-9-29(21)35)33(26-6-10-30(36)22(2)18-26)13-15-34(16-14-33,27-7-11-31(37)23(3)19-27)28-8-12-32(38)24(4)20-28/h5-12,17-20,35-38H,13-16H2,1-4H3.
What are the key properties of 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol?
2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol has a molecular weight of 508.66 g/mol, XLogP of 7.59, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[1,4,4-tris(4-hydroxy-3-methylphenyl)cyclohexyl]phenol is sourced from PubChem (CID 23454249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).