About 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran
2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran (PubChem CID 23454494) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran |
| PubChem CID | 23454494 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran |
| SMILES | CC1=CC(C)OC(C2CC3C=CC2C3)C1 |
| InChI | InChI=1S/C14H20O/c1-9-5-10(2)15-14(6-9)13-8-11-3-4-12(13)7-11/h3-5,10-14H,6-8H2,1-2H3 |
| InChIKey | KJPGDIOQYOBBDT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran?
The IUPAC name of 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran (CID 23454494) is 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran?
The canonical SMILES for 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran is CC1=CC(C)OC(C2CC3C=CC2C3)C1.
What is the InChIKey of 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran?
The InChIKey is KJPGDIOQYOBBDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-9-5-10(2)15-14(6-9)13-8-11-3-4-12(13)7-11/h3-5,10-14H,6-8H2,1-2H3.
What are the key properties of 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran?
2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran has a molecular weight of 204.31 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[2.2.1]hept-5-enyl)-4,6-dimethyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 23454494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).