C14H20O — CID 23454495
4-methyl-2-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-3,6-dihydro-2H-pyran (PubChem CID 23454495) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 4-methyl-2-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-3,6-dihydro-2H-pyran.
| Compound Name | 4-methyl-2-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 23454495 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 4-methyl-2-(3-methyl-2-bicyclo[2.2.1]hept-5-enyl)-3,6-dihydro-2H-pyran |
| SMILES | CC1=CCOC(C2C3C=CC(C3)C2C)C1 |
| InChI | InChI=1S/C14H20O/c1-9-5-6-15-13(7-9)14-10(2)11-3-4-12(14)8-11/h3-5,10-14H,6-8H2,1-2H3 |
| InChIKey | XYJSBZSDXACTCV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|