C14H23O3P — CID 23454647
2,2-dimethylpropyl (2,4,6-trimethylphenyl) hydrogen phosphite (PubChem CID 23454647) has the molecular formula C14H23O3P and a molecular weight of 270.31 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2,4,6-trimethylphenyl) hydrogen phosphite.
| Compound Name | 2,2-dimethylpropyl (2,4,6-trimethylphenyl) hydrogen phosphite |
|---|---|
| PubChem CID | 23454647 |
| Molecular Formula | C14H23O3P |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2,2-dimethylpropyl (2,4,6-trimethylphenyl) hydrogen phosphite |
| SMILES | Cc1cc(C)c(OP(O)OCC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H23O3P/c1-10-7-11(2)13(12(3)8-10)17-18(15)16-9-14(4,5)6/h7-8,15H,9H2,1-6H3 |
| InChIKey | IUWLERBVQNGVED-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|