About 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate
2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate (PubChem CID 23454791) has the molecular formula C7H12N6O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate.
Molecular Properties
| Compound Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate |
| PubChem CID | 23454791 |
| Molecular Formula | C7H12N6O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate |
| SMILES | Nc1n[nH]c(C2(N)C=CC=CN2)n1.O |
| InChI | InChI=1S/C7H10N6.H2O/c8-6-11-5(12-13-6)7(9)3-1-2-4-10-7;/h1-4,10H,9H2,(H3,8,11,12,13);1H2 |
| InChIKey | FXZLTFQCFNRXTD-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate?
The IUPAC name of 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate (CID 23454791) is 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate.
What is the SMILES notation for 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate?
The canonical SMILES for 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate is Nc1n[nH]c(C2(N)C=CC=CN2)n1.O.
What is the InChIKey of 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate?
The InChIKey is FXZLTFQCFNRXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6.H2O/c8-6-11-5(12-13-6)7(9)3-1-2-4-10-7;/h1-4,10H,9H2,(H3,8,11,12,13);1H2.
What are the key properties of 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate?
2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate has a molecular weight of 196.21 g/mol, XLogP of -1.65, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1H-1,2,4-triazol-5-yl)-1H-pyridin-2-amine;hydrate is sourced from PubChem (CID 23454791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).