About bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate
bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate (PubChem CID 23455101) has the molecular formula C22H28O4S2Sn
and a molecular weight of 539.31 g/mol. Its IUPAC name is bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate.
Molecular Properties
| Compound Name | bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate |
| PubChem CID | 23455101 |
| Molecular Formula | C22H28O4S2Sn |
| Molecular Weight | 539.31 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate |
| SMILES | COC(=O)CC[Sn+2]CCC(=O)OC.[S-]Cc1ccccc1.[S-]Cc1ccccc1 |
| InChI | InChI=1S/2C7H8S.2C4H7O2.Sn/c2*8-6-7-4-2-1-3-5-7;2*1-3-4(5)6-2;/h2*1-5,8H,6H2;2*1,3H2,2H3;/q;;;;+2/p-2 |
| InChIKey | NSRQBRLJTRWGQB-UHFFFAOYSA-L |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate?
The IUPAC name of bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate (CID 23455101) is bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate.
What is the SMILES notation for bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate?
The canonical SMILES for bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate is COC(=O)CC[Sn+2]CCC(=O)OC.[S-]Cc1ccccc1.[S-]Cc1ccccc1.
What is the InChIKey of bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate?
The InChIKey is NSRQBRLJTRWGQB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8S.2C4H7O2.Sn/c2*8-6-7-4-2-1-3-5-7;2*1-3-4(5)6-2;/h2*1-5,8H,6H2;2*1,3H2,2H3;/q;;;;+2/p-2.
What are the key properties of bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate?
bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate has a molecular weight of 539.31 g/mol, XLogP of 4.12, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methoxy-3-oxopropyl)tin(2+);phenylmethanethiolate is sourced from PubChem (CID 23455101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).