C15H20N2O2 — CID 23456500
8-butoxy-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one (PubChem CID 23456500) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 8-butoxy-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one.
| Compound Name | 8-butoxy-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one |
|---|---|
| PubChem CID | 23456500 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 8-butoxy-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one |
| SMILES | CCCCOc1ccc2c(c1)C(=O)N1CCNCC21 |
| InChI | InChI=1S/C15H20N2O2/c1-2-3-8-19-11-4-5-12-13(9-11)15(18)17-7-6-16-10-14(12)17/h4-5,9,14,16H,2-3,6-8,10H2,1H3 |
| InChIKey | GVEPZCUNVRTQKK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|