C15H18N2O2 — CID 23456596
3,3,4,4-tetramethyl-2,10b-dihydropyrazino[1,2-b]isoindole-1,6-dione (PubChem CID 23456596) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-2,10b-dihydropyrazino[1,2-b]isoindole-1,6-dione.
| Compound Name | 3,3,4,4-tetramethyl-2,10b-dihydropyrazino[1,2-b]isoindole-1,6-dione |
|---|---|
| PubChem CID | 23456596 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3,3,4,4-tetramethyl-2,10b-dihydropyrazino[1,2-b]isoindole-1,6-dione |
| SMILES | CC1(C)NC(=O)C2c3ccccc3C(=O)N2C1(C)C |
| InChI | InChI=1S/C15H18N2O2/c1-14(2)15(3,4)17-11(12(18)16-14)9-7-5-6-8-10(9)13(17)19/h5-8,11H,1-4H3,(H,16,18) |
| InChIKey | SXJSDAZARHVYFU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |