C12H14N4O2 — CID 23456628
1-ethylspiro[2,3-dihydro-1,8-naphthyridine-4,5'-imidazolidine]-2',4'-dione (PubChem CID 23456628) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-ethylspiro[2,3-dihydro-1,8-naphthyridine-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1-ethylspiro[2,3-dihydro-1,8-naphthyridine-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 23456628 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-ethylspiro[2,3-dihydro-1,8-naphthyridine-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CCN1CCC2(NC(=O)NC2=O)c2cccnc21 |
| InChI | InChI=1S/C12H14N4O2/c1-2-16-7-5-12(10(17)14-11(18)15-12)8-4-3-6-13-9(8)16/h3-4,6H,2,5,7H2,1H3,(H2,14,15,17,18) |
| InChIKey | QLWWAGCRRBZKLG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|