C25H19N3O4 — CID 23457364
N-benzhydryl-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide (PubChem CID 23457364) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-benzhydryl-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-benzhydryl-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 23457364 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-benzhydryl-2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)c1ccc2c(c1)Cc1c([nH]c(=O)[nH]c1=O)O2 |
| InChI | InChI=1S/C25H19N3O4/c29-22(26-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16)17-11-12-20-18(13-17)14-19-23(30)27-25(31)28-24(19)32-20/h1-13,21H,14H2,(H,26,29)(H2,27,28,30,31) |
| InChIKey | VQBXSQZHZVLTQP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |