About (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate
(4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate (PubChem CID 23457810) has the molecular formula C23H37NO4
and a molecular weight of 391.55 g/mol. Its IUPAC name is (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate.
Molecular Properties
| Compound Name | (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate |
| PubChem CID | 23457810 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate |
| SMILES | CCCCCCCCCCNc1ccc(C(=O)OC(C)CC(=O)OCC)cc1 |
| InChI | InChI=1S/C23H37NO4/c1-4-6-7-8-9-10-11-12-17-24-21-15-13-20(14-16-21)23(26)28-19(3)18-22(25)27-5-2/h13-16,19,24H,4-12,17-18H2,1-3H3 |
| InChIKey | HQNMZCACKQRAMN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate?
The IUPAC name of (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate (CID 23457810) is (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate.
What is the SMILES notation for (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate?
The canonical SMILES for (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate is CCCCCCCCCCNc1ccc(C(=O)OC(C)CC(=O)OCC)cc1.
What is the InChIKey of (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate?
The InChIKey is HQNMZCACKQRAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37NO4/c1-4-6-7-8-9-10-11-12-17-24-21-15-13-20(14-16-21)23(26)28-19(3)18-22(25)27-5-2/h13-16,19,24H,4-12,17-18H2,1-3H3.
What are the key properties of (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate?
(4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate has a molecular weight of 391.55 g/mol, XLogP of 5.74, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-4-oxobutan-2-yl) 4-(decylamino)benzoate is sourced from PubChem (CID 23457810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).