C14H15F6NO3 — CID 23457921
methyl 2-[4-(2-amino-1,1,2,3,3,3-hexafluoropropyl)-2,6-dimethylphenoxy]acetate (PubChem CID 23457921) has the molecular formula C14H15F6NO3 and a molecular weight of 359.27 g/mol. Its IUPAC name is methyl 2-[4-(2-amino-1,1,2,3,3,3-hexafluoropropyl)-2,6-dimethylphenoxy]acetate.
| Compound Name | methyl 2-[4-(2-amino-1,1,2,3,3,3-hexafluoropropyl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 23457921 |
| Molecular Formula | C14H15F6NO3 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl 2-[4-(2-amino-1,1,2,3,3,3-hexafluoropropyl)-2,6-dimethylphenoxy]acetate |
| SMILES | COC(=O)COc1c(C)cc(C(F)(F)C(N)(F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C14H15F6NO3/c1-7-4-9(12(15,16)13(17,21)14(18,19)20)5-8(2)11(7)24-6-10(22)23-3/h4-5H,6,21H2,1-3H3 |
| InChIKey | AKRKUMKLQZARKF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|