C16H26O — CID 23458134
2-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)-4,6-dimethyl-3,6-dihydro-2H-pyran (PubChem CID 23458134) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)-4,6-dimethyl-3,6-dihydro-2H-pyran.
| Compound Name | 2-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)-4,6-dimethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 23458134 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)-4,6-dimethyl-3,6-dihydro-2H-pyran |
| SMILES | CC1=CC(C)OC(C2C3CCC(C3)C2(C)C)C1 |
| InChI | InChI=1S/C16H26O/c1-10-7-11(2)17-14(8-10)15-12-5-6-13(9-12)16(15,3)4/h7,11-15H,5-6,8-9H2,1-4H3 |
| InChIKey | GDENEOFASCQALK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|