About 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol
7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol (PubChem CID 23458142) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol.
Molecular Properties
| Compound Name | 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol |
| PubChem CID | 23458142 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol |
| SMILES | C=CC(O)CCCC(C=C)CCN(C)C |
| InChI | InChI=1S/C13H25NO/c1-5-12(10-11-14(3)4)8-7-9-13(15)6-2/h5-6,12-13,15H,1-2,7-11H2,3-4H3 |
| InChIKey | ZNKUGJWOLMYKDD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol?
The IUPAC name of 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol (CID 23458142) is 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol.
What is the SMILES notation for 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol?
The canonical SMILES for 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol is C=CC(O)CCCC(C=C)CCN(C)C.
What is the InChIKey of 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol?
The InChIKey is ZNKUGJWOLMYKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-5-12(10-11-14(3)4)8-7-9-13(15)6-2/h5-6,12-13,15H,1-2,7-11H2,3-4H3.
What are the key properties of 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol?
7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol has a molecular weight of 211.35 g/mol, XLogP of 2.46, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(dimethylamino)ethyl]nona-1,8-dien-3-ol is sourced from PubChem (CID 23458142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).