About 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde
4-amino-2,6-dimethylpyrimidine-5-carbaldehyde (PubChem CID 23458572) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde |
| PubChem CID | 23458572 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(C)c(C=O)c(N)n1 |
| InChI | InChI=1S/C7H9N3O/c1-4-6(3-11)7(8)10-5(2)9-4/h3H,1-2H3,(H2,8,9,10) |
| InChIKey | OCWXAMOERPXSHX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde?
The IUPAC name of 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde (CID 23458572) is 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde.
What is the SMILES notation for 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde?
The canonical SMILES for 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde is Cc1nc(C)c(C=O)c(N)n1.
What is the InChIKey of 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde?
The InChIKey is OCWXAMOERPXSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-4-6(3-11)7(8)10-5(2)9-4/h3H,1-2H3,(H2,8,9,10).
What are the key properties of 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde?
4-amino-2,6-dimethylpyrimidine-5-carbaldehyde has a molecular weight of 151.17 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-dimethylpyrimidine-5-carbaldehyde is sourced from PubChem (CID 23458572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).