About 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione
4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione (PubChem CID 23459227) has the molecular formula C7H13N3S
and a molecular weight of 171.27 g/mol. Its IUPAC name is 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione |
| PubChem CID | 23459227 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)CCn1cn[nH]c1=S |
| InChI | InChI=1S/C7H13N3S/c1-6(2)3-4-10-5-8-9-7(10)11/h5-6H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | OGUZUFFHDVOMKK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione?
The IUPAC name of 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione (CID 23459227) is 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione is CC(C)CCn1cn[nH]c1=S.
What is the InChIKey of 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione?
The InChIKey is OGUZUFFHDVOMKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S/c1-6(2)3-4-10-5-8-9-7(10)11/h5-6H,3-4H2,1-2H3,(H,9,11).
What are the key properties of 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione?
4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione has a molecular weight of 171.27 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutyl)-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 23459227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).