About 2-methylaniline;1,3-thiazole
2-methylaniline;1,3-thiazole (PubChem CID 23459362) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 2-methylaniline;1,3-thiazole.
Molecular Properties
| Compound Name | 2-methylaniline;1,3-thiazole |
| PubChem CID | 23459362 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-methylaniline;1,3-thiazole |
| SMILES | Cc1ccccc1N.c1cscn1 |
| InChI | InChI=1S/C7H9N.C3H3NS/c1-6-4-2-3-5-7(6)8;1-2-5-3-4-1/h2-5H,8H2,1H3;1-3H |
| InChIKey | GYNODXWLQDGZLI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;1,3-thiazole?
The IUPAC name of 2-methylaniline;1,3-thiazole (CID 23459362) is 2-methylaniline;1,3-thiazole.
What is the SMILES notation for 2-methylaniline;1,3-thiazole?
The canonical SMILES for 2-methylaniline;1,3-thiazole is Cc1ccccc1N.c1cscn1.
What is the InChIKey of 2-methylaniline;1,3-thiazole?
The InChIKey is GYNODXWLQDGZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C3H3NS/c1-6-4-2-3-5-7(6)8;1-2-5-3-4-1/h2-5H,8H2,1H3;1-3H.
What are the key properties of 2-methylaniline;1,3-thiazole?
2-methylaniline;1,3-thiazole has a molecular weight of 192.29 g/mol, XLogP of 2.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;1,3-thiazole is sourced from PubChem (CID 23459362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).