About 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde
2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde (PubChem CID 23459397) has the molecular formula C5H5NO2S
and a molecular weight of 143.17 g/mol. Its IUPAC name is 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde |
| PubChem CID | 23459397 |
| Molecular Formula | C5H5NO2S |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.00 |
| IUPAC Name | 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde |
| SMILES | O=CC(O)c1ccsn1 |
| InChI | InChI=1S/C5H5NO2S/c7-3-5(8)4-1-2-9-6-4/h1-3,5,8H |
| InChIKey | KXGLRYPQDMFFOA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde?
The IUPAC name of 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde (CID 23459397) is 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde.
What is the SMILES notation for 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde?
The canonical SMILES for 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde is O=CC(O)c1ccsn1.
What is the InChIKey of 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde?
The InChIKey is KXGLRYPQDMFFOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2S/c7-3-5(8)4-1-2-9-6-4/h1-3,5,8H.
What are the key properties of 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde?
2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde has a molecular weight of 143.17 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(1,2-thiazol-3-yl)acetaldehyde is sourced from PubChem (CID 23459397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).