About 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine
2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine (PubChem CID 23459455) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine |
| PubChem CID | 23459455 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine |
| SMILES | NCCC1(c2ccccc2)C=CCC=C1 |
| InChI | InChI=1S/C14H17N/c15-12-11-14(9-5-2-6-10-14)13-7-3-1-4-8-13/h1,3-10H,2,11-12,15H2 |
| InChIKey | ZSWGJNMNTHUKPI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine?
The IUPAC name of 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine (CID 23459455) is 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine.
What is the SMILES notation for 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine?
The canonical SMILES for 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine is NCCC1(c2ccccc2)C=CCC=C1.
What is the InChIKey of 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine?
The InChIKey is ZSWGJNMNTHUKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N/c15-12-11-14(9-5-2-6-10-14)13-7-3-1-4-8-13/h1,3-10H,2,11-12,15H2.
What are the key properties of 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine?
2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine has a molecular weight of 199.30 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylcyclohexa-2,5-dien-1-yl)ethanamine is sourced from PubChem (CID 23459455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).