About 4H-pyrido[1,2-a]pyrimidine-2,3-dione
4H-pyrido[1,2-a]pyrimidine-2,3-dione (PubChem CID 23459858) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 4H-pyrido[1,2-a]pyrimidine-2,3-dione.
Molecular Properties
| Compound Name | 4H-pyrido[1,2-a]pyrimidine-2,3-dione |
| PubChem CID | 23459858 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4H-pyrido[1,2-a]pyrimidine-2,3-dione |
| SMILES | O=C1CN2C=CC=CC2=NC1=O |
| InChI | InChI=1S/C8H6N2O2/c11-6-5-10-4-2-1-3-7(10)9-8(6)12/h1-4H,5H2 |
| InChIKey | RJURQOGJQYMSDE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4H-pyrido[1,2-a]pyrimidine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrido[1,2-a]pyrimidine-2,3-dione?
The IUPAC name of 4H-pyrido[1,2-a]pyrimidine-2,3-dione (CID 23459858) is 4H-pyrido[1,2-a]pyrimidine-2,3-dione.
What is the SMILES notation for 4H-pyrido[1,2-a]pyrimidine-2,3-dione?
The canonical SMILES for 4H-pyrido[1,2-a]pyrimidine-2,3-dione is O=C1CN2C=CC=CC2=NC1=O.
What is the InChIKey of 4H-pyrido[1,2-a]pyrimidine-2,3-dione?
The InChIKey is RJURQOGJQYMSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-6-5-10-4-2-1-3-7(10)9-8(6)12/h1-4H,5H2.
What are the key properties of 4H-pyrido[1,2-a]pyrimidine-2,3-dione?
4H-pyrido[1,2-a]pyrimidine-2,3-dione has a molecular weight of 162.15 g/mol, XLogP of -0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[1,2-a]pyrimidine-2,3-dione is sourced from PubChem (CID 23459858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).