About pyrimido[1,2-a]benzimidazole-8,9-dione
pyrimido[1,2-a]benzimidazole-8,9-dione (PubChem CID 23459861) has the molecular formula C10H5N3O2
and a molecular weight of 199.17 g/mol. Its IUPAC name is pyrimido[1,2-a]benzimidazole-8,9-dione.
Molecular Properties
| Compound Name | pyrimido[1,2-a]benzimidazole-8,9-dione |
| PubChem CID | 23459861 |
| Molecular Formula | C10H5N3O2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | pyrimido[1,2-a]benzimidazole-8,9-dione |
| SMILES | O=C1C=Cc2c(nc3ncccn23)C1=O |
| InChI | InChI=1S/C10H5N3O2/c14-7-3-2-6-8(9(7)15)12-10-11-4-1-5-13(6)10/h1-5H |
| InChIKey | MVOMTFKWVAGQPY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze pyrimido[1,2-a]benzimidazole-8,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[1,2-a]benzimidazole-8,9-dione?
The IUPAC name of pyrimido[1,2-a]benzimidazole-8,9-dione (CID 23459861) is pyrimido[1,2-a]benzimidazole-8,9-dione.
What is the SMILES notation for pyrimido[1,2-a]benzimidazole-8,9-dione?
The canonical SMILES for pyrimido[1,2-a]benzimidazole-8,9-dione is O=C1C=Cc2c(nc3ncccn23)C1=O.
What is the InChIKey of pyrimido[1,2-a]benzimidazole-8,9-dione?
The InChIKey is MVOMTFKWVAGQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3O2/c14-7-3-2-6-8(9(7)15)12-10-11-4-1-5-13(6)10/h1-5H.
What are the key properties of pyrimido[1,2-a]benzimidazole-8,9-dione?
pyrimido[1,2-a]benzimidazole-8,9-dione has a molecular weight of 199.17 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[1,2-a]benzimidazole-8,9-dione is sourced from PubChem (CID 23459861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).