About 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine
2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine (PubChem CID 23460165) has the molecular formula C9H9Br2N3
and a molecular weight of 319.00 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine.
Molecular Properties
| Compound Name | 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine |
| PubChem CID | 23460165 |
| Molecular Formula | C9H9Br2N3 |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C9H9Br2N3/c10-6-1-2-8(7(11)5-6)14-4-3-9(12)13-14/h1-2,5H,3-4H2,(H2,12,13) |
| InChIKey | XJWBSBRGRFLFIX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine?
The IUPAC name of 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine (CID 23460165) is 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine.
What is the SMILES notation for 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine?
The canonical SMILES for 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine is NC1=NN(c2ccc(Br)cc2Br)CC1.
What is the InChIKey of 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine?
The InChIKey is XJWBSBRGRFLFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Br2N3/c10-6-1-2-8(7(11)5-6)14-4-3-9(12)13-14/h1-2,5H,3-4H2,(H2,12,13).
What are the key properties of 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine?
2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine has a molecular weight of 319.00 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dibromophenyl)-3,4-dihydropyrazol-5-amine is sourced from PubChem (CID 23460165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).