About pyrido[1,2-a]pyrimidin-2-one;hydrobromide
pyrido[1,2-a]pyrimidin-2-one;hydrobromide (PubChem CID 23460792) has the molecular formula C8H7BrN2O
and a molecular weight of 227.06 g/mol. Its IUPAC name is pyrido[1,2-a]pyrimidin-2-one;hydrobromide.
Molecular Properties
| Compound Name | pyrido[1,2-a]pyrimidin-2-one;hydrobromide |
| PubChem CID | 23460792 |
| Molecular Formula | C8H7BrN2O |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | pyrido[1,2-a]pyrimidin-2-one;hydrobromide |
| SMILES | Br.O=c1ccn2ccccc2n1 |
| InChI | InChI=1S/C8H6N2O.BrH/c11-8-4-6-10-5-2-1-3-7(10)9-8;/h1-6H;1H |
| InChIKey | JYNVXRWLUNBOCU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrido[1,2-a]pyrimidin-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[1,2-a]pyrimidin-2-one;hydrobromide?
The IUPAC name of pyrido[1,2-a]pyrimidin-2-one;hydrobromide (CID 23460792) is pyrido[1,2-a]pyrimidin-2-one;hydrobromide.
What is the SMILES notation for pyrido[1,2-a]pyrimidin-2-one;hydrobromide?
The canonical SMILES for pyrido[1,2-a]pyrimidin-2-one;hydrobromide is Br.O=c1ccn2ccccc2n1.
What is the InChIKey of pyrido[1,2-a]pyrimidin-2-one;hydrobromide?
The InChIKey is JYNVXRWLUNBOCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.BrH/c11-8-4-6-10-5-2-1-3-7(10)9-8;/h1-6H;1H.
What are the key properties of pyrido[1,2-a]pyrimidin-2-one;hydrobromide?
pyrido[1,2-a]pyrimidin-2-one;hydrobromide has a molecular weight of 227.06 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[1,2-a]pyrimidin-2-one;hydrobromide is sourced from PubChem (CID 23460792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).