About ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate
ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate (PubChem CID 23461232) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate |
| PubChem CID | 23461232 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCC.C=C(CC)C(=O)OCCCCCC |
| InChI | InChI=1S/C11H20O2.C6H10O2/c1-4-6-7-8-9-13-11(12)10(3)5-2;1-4-8-6(7)5(2)3/h3-9H2,1-2H3;2,4H2,1,3H3 |
| InChIKey | LZGMUFISGBPTNV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate?
The IUPAC name of ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate (CID 23461232) is ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate.
What is the SMILES notation for ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate?
The canonical SMILES for ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate is C=C(C)C(=O)OCC.C=C(CC)C(=O)OCCCCCC.
What is the InChIKey of ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate?
The InChIKey is LZGMUFISGBPTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.C6H10O2/c1-4-6-7-8-9-13-11(12)10(3)5-2;1-4-8-6(7)5(2)3/h3-9H2,1-2H3;2,4H2,1,3H3.
What are the key properties of ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate?
ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate has a molecular weight of 298.42 g/mol, XLogP of 4.20, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylprop-2-enoate;hexyl 2-methylidenebutanoate is sourced from PubChem (CID 23461232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).