About dipropan-2-yl prop-2-enyl phosphate
dipropan-2-yl prop-2-enyl phosphate (PubChem CID 23461269) has the molecular formula C9H19O4P
and a molecular weight of 222.22 g/mol. Its IUPAC name is dipropan-2-yl prop-2-enyl phosphate.
Molecular Properties
| Compound Name | dipropan-2-yl prop-2-enyl phosphate |
| PubChem CID | 23461269 |
| Molecular Formula | C9H19O4P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | dipropan-2-yl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C9H19O4P/c1-6-7-11-14(10,12-8(2)3)13-9(4)5/h6,8-9H,1,7H2,2-5H3 |
| InChIKey | QOTHOFXANYUVLG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl prop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl prop-2-enyl phosphate?
The IUPAC name of dipropan-2-yl prop-2-enyl phosphate (CID 23461269) is dipropan-2-yl prop-2-enyl phosphate.
What is the SMILES notation for dipropan-2-yl prop-2-enyl phosphate?
The canonical SMILES for dipropan-2-yl prop-2-enyl phosphate is C=CCOP(=O)(OC(C)C)OC(C)C.
What is the InChIKey of dipropan-2-yl prop-2-enyl phosphate?
The InChIKey is QOTHOFXANYUVLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19O4P/c1-6-7-11-14(10,12-8(2)3)13-9(4)5/h6,8-9H,1,7H2,2-5H3.
What are the key properties of dipropan-2-yl prop-2-enyl phosphate?
dipropan-2-yl prop-2-enyl phosphate has a molecular weight of 222.22 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl prop-2-enyl phosphate is sourced from PubChem (CID 23461269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).