About 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one
6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one (PubChem CID 23461697) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one.
Molecular Properties
| Compound Name | 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one |
| PubChem CID | 23461697 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one |
| SMILES | O=C1Cc2ccc3c(c2C1)OCO3 |
| InChI | InChI=1S/C10H8O3/c11-7-3-6-1-2-9-10(8(6)4-7)13-5-12-9/h1-2H,3-5H2 |
| InChIKey | CWTZSKLLVDAKHH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one?
The IUPAC name of 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one (CID 23461697) is 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one.
What is the SMILES notation for 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one?
The canonical SMILES for 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one is O=C1Cc2ccc3c(c2C1)OCO3.
What is the InChIKey of 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one?
The InChIKey is CWTZSKLLVDAKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3/c11-7-3-6-1-2-9-10(8(6)4-7)13-5-12-9/h1-2H,3-5H2.
What are the key properties of 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one?
6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one has a molecular weight of 176.17 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydrocyclopenta[g][1,3]benzodioxol-7-one is sourced from PubChem (CID 23461697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).