About pyrazin-2-ylmethyl prop-2-enoate
pyrazin-2-ylmethyl prop-2-enoate (PubChem CID 23462019) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is pyrazin-2-ylmethyl prop-2-enoate.
Molecular Properties
| Compound Name | pyrazin-2-ylmethyl prop-2-enoate |
| PubChem CID | 23462019 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | pyrazin-2-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cnccn1 |
| InChI | InChI=1S/C8H8N2O2/c1-2-8(11)12-6-7-5-9-3-4-10-7/h2-5H,1,6H2 |
| InChIKey | ORGCZMUUWOJDQE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pyrazin-2-ylmethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-ylmethyl prop-2-enoate?
The IUPAC name of pyrazin-2-ylmethyl prop-2-enoate (CID 23462019) is pyrazin-2-ylmethyl prop-2-enoate.
What is the SMILES notation for pyrazin-2-ylmethyl prop-2-enoate?
The canonical SMILES for pyrazin-2-ylmethyl prop-2-enoate is C=CC(=O)OCc1cnccn1.
What is the InChIKey of pyrazin-2-ylmethyl prop-2-enoate?
The InChIKey is ORGCZMUUWOJDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-2-8(11)12-6-7-5-9-3-4-10-7/h2-5H,1,6H2.
What are the key properties of pyrazin-2-ylmethyl prop-2-enoate?
pyrazin-2-ylmethyl prop-2-enoate has a molecular weight of 164.16 g/mol, XLogP of 0.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-ylmethyl prop-2-enoate is sourced from PubChem (CID 23462019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).