C7H12N2O — CID 23462112
4-(methoxymethyl)-2,5-dimethyl-1H-imidazole (PubChem CID 23462112) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4-(methoxymethyl)-2,5-dimethyl-1H-imidazole.
| Compound Name | 4-(methoxymethyl)-2,5-dimethyl-1H-imidazole |
|---|---|
| PubChem CID | 23462112 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4-(methoxymethyl)-2,5-dimethyl-1H-imidazole |
| SMILES | COCc1nc(C)[nH]c1C |
| InChI | InChI=1S/C7H12N2O/c1-5-7(4-10-3)9-6(2)8-5/h4H2,1-3H3,(H,8,9) |
| InChIKey | GIJUPFHEPFPJCU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |