About (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride
(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride (PubChem CID 23462411) has the molecular formula C11H15ClN2O2S
and a molecular weight of 274.77 g/mol. Its IUPAC name is (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride.
Molecular Properties
| Compound Name | (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride |
| PubChem CID | 23462411 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride |
| SMILES | CCCC(=O)OCc1cn2c(C)csc2n1.Cl |
| InChI | InChI=1S/C11H14N2O2S.ClH/c1-3-4-10(14)15-6-9-5-13-8(2)7-16-11(13)12-9;/h5,7H,3-4,6H2,1-2H3;1H |
| InChIKey | MBSVBIWDDIEDNB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride?
The IUPAC name of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride (CID 23462411) is (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride.
What is the SMILES notation for (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride?
The canonical SMILES for (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride is CCCC(=O)OCc1cn2c(C)csc2n1.Cl.
What is the InChIKey of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride?
The InChIKey is MBSVBIWDDIEDNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2S.ClH/c1-3-4-10(14)15-6-9-5-13-8(2)7-16-11(13)12-9;/h5,7H,3-4,6H2,1-2H3;1H.
What are the key properties of (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride?
(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride has a molecular weight of 274.77 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate;hydrochloride is sourced from PubChem (CID 23462411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).