C18H28O2 — CID 23462551
4-but-3-enyl-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 23462551) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-but-3-enyl-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | 4-but-3-enyl-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 23462551 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 4-but-3-enyl-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | C=CCCC1=C2CCC(OC(C)(C)C)C2(C)CCC1=O |
| InChI | InChI=1S/C18H28O2/c1-6-7-8-13-14-9-10-16(20-17(2,3)4)18(14,5)12-11-15(13)19/h6,16H,1,7-12H2,2-5H3 |
| InChIKey | MMYSNPLUEHJWQU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|