C13H18O2 — CID 23462555
1-butoxy-1,2,3,6-tetrahydroinden-5-one (PubChem CID 23462555) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-butoxy-1,2,3,6-tetrahydroinden-5-one.
| Compound Name | 1-butoxy-1,2,3,6-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 23462555 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-butoxy-1,2,3,6-tetrahydroinden-5-one |
| SMILES | CCCCOC1CCC2=CC(=O)CC=C21 |
| InChI | InChI=1S/C13H18O2/c1-2-3-8-15-13-7-4-10-9-11(14)5-6-12(10)13/h6,9,13H,2-5,7-8H2,1H3 |
| InChIKey | RTTSGFGTVFYXPK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|