C18H22BrNO3S — CID 23462862
3-(2-hydroxyethyl)-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide (PubChem CID 23462862) has the molecular formula C18H22BrNO3S and a molecular weight of 412.35 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide.
| Compound Name | 3-(2-hydroxyethyl)-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
|---|---|
| PubChem CID | 23462862 |
| Molecular Formula | C18H22BrNO3S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 3-(2-hydroxyethyl)-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
| SMILES | Br.OCCN1CCc2cc(O)c(O)c(Sc3ccccc3)c2CC1 |
| InChI | InChI=1S/C18H21NO3S.BrH/c20-11-10-19-8-6-13-12-16(21)17(22)18(15(13)7-9-19)23-14-4-2-1-3-5-14;/h1-5,12,20-22H,6-11H2;1H |
| InChIKey | MIUCMXGFQYFVSU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|