C9H10N4S — CID 23463033
5-(2,4-dimethyl-3-pyridinyl)-1,3,4-thiadiazol-2-amine (PubChem CID 23463033) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-(2,4-dimethyl-3-pyridinyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,4-dimethyl-3-pyridinyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 23463033 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-(2,4-dimethyl-3-pyridinyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1ccnc(C)c1-c1nnc(N)s1 |
| InChI | InChI=1S/C9H10N4S/c1-5-3-4-11-6(2)7(5)8-12-13-9(10)14-8/h3-4H,1-2H3,(H2,10,13) |
| InChIKey | QQNLTPBLQPQRRA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |