About phenacyl pyridine-4-carboxylate
phenacyl pyridine-4-carboxylate (PubChem CID 2346313) has the molecular formula C14H11NO3
and a molecular weight of 241.25 g/mol. Its IUPAC name is phenacyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | phenacyl pyridine-4-carboxylate |
| PubChem CID | 2346313 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | phenacyl pyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C14H11NO3/c16-13(11-4-2-1-3-5-11)10-18-14(17)12-6-8-15-9-7-12/h1-9H,10H2 |
| InChIKey | VLJKXPUQNREOQD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenacyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl pyridine-4-carboxylate?
The IUPAC name of phenacyl pyridine-4-carboxylate (CID 2346313) is phenacyl pyridine-4-carboxylate.
What is the SMILES notation for phenacyl pyridine-4-carboxylate?
The canonical SMILES for phenacyl pyridine-4-carboxylate is O=C(COC(=O)c1ccncc1)c1ccccc1.
What is the InChIKey of phenacyl pyridine-4-carboxylate?
The InChIKey is VLJKXPUQNREOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3/c16-13(11-4-2-1-3-5-11)10-18-14(17)12-6-8-15-9-7-12/h1-9H,10H2.
What are the key properties of phenacyl pyridine-4-carboxylate?
phenacyl pyridine-4-carboxylate has a molecular weight of 241.25 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl pyridine-4-carboxylate is sourced from PubChem (CID 2346313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).