C12H16O3 — CID 23463508
ethyl 3-formyl-5-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23463508) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is ethyl 3-formyl-5-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl 3-formyl-5-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 23463508 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethyl 3-formyl-5-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)C1C2C=C(C)C(C2)C1C=O |
| InChI | InChI=1S/C12H16O3/c1-3-15-12(14)11-8-4-7(2)9(5-8)10(11)6-13/h4,6,8-11H,3,5H2,1-2H3 |
| InChIKey | GXGKYVMRJMFFPB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|