About N-(3-amino-2,5-dichlorophenyl)ethanethioamide
N-(3-amino-2,5-dichlorophenyl)ethanethioamide (PubChem CID 23464363) has the molecular formula C8H8Cl2N2S
and a molecular weight of 235.14 g/mol. Its IUPAC name is N-(3-amino-2,5-dichlorophenyl)ethanethioamide.
Molecular Properties
| Compound Name | N-(3-amino-2,5-dichlorophenyl)ethanethioamide |
| PubChem CID | 23464363 |
| Molecular Formula | C8H8Cl2N2S |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | N-(3-amino-2,5-dichlorophenyl)ethanethioamide |
| SMILES | CC(=S)Nc1cc(Cl)cc(N)c1Cl |
| InChI | InChI=1S/C8H8Cl2N2S/c1-4(13)12-7-3-5(9)2-6(11)8(7)10/h2-3H,11H2,1H3,(H,12,13) |
| InChIKey | FUGCEWTUBZEBKE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-amino-2,5-dichlorophenyl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,5-dichlorophenyl)ethanethioamide?
The IUPAC name of N-(3-amino-2,5-dichlorophenyl)ethanethioamide (CID 23464363) is N-(3-amino-2,5-dichlorophenyl)ethanethioamide.
What is the SMILES notation for N-(3-amino-2,5-dichlorophenyl)ethanethioamide?
The canonical SMILES for N-(3-amino-2,5-dichlorophenyl)ethanethioamide is CC(=S)Nc1cc(Cl)cc(N)c1Cl.
What is the InChIKey of N-(3-amino-2,5-dichlorophenyl)ethanethioamide?
The InChIKey is FUGCEWTUBZEBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2S/c1-4(13)12-7-3-5(9)2-6(11)8(7)10/h2-3H,11H2,1H3,(H,12,13).
What are the key properties of N-(3-amino-2,5-dichlorophenyl)ethanethioamide?
N-(3-amino-2,5-dichlorophenyl)ethanethioamide has a molecular weight of 235.14 g/mol, XLogP of 3.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,5-dichlorophenyl)ethanethioamide is sourced from PubChem (CID 23464363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).