C14H6Br4N2O2 — CID 23465317
2,7-diamino-1,3,6,8-tetrabromoanthracene-9,10-dione (PubChem CID 23465317) has the molecular formula C14H6Br4N2O2 and a molecular weight of 553.83 g/mol. Its IUPAC name is 2,7-diamino-1,3,6,8-tetrabromoanthracene-9,10-dione.
| Compound Name | 2,7-diamino-1,3,6,8-tetrabromoanthracene-9,10-dione |
|---|---|
| PubChem CID | 23465317 |
| Molecular Formula | C14H6Br4N2O2 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 549.72 |
| IUPAC Name | 2,7-diamino-1,3,6,8-tetrabromoanthracene-9,10-dione |
| SMILES | Nc1c(Br)cc2c(c1Br)C(=O)c1c(cc(Br)c(N)c1Br)C2=O |
| InChI | InChI=1S/C14H6Br4N2O2/c15-5-1-3-7(9(17)11(5)19)14(22)8-4(13(3)21)2-6(16)12(20)10(8)18/h1-2H,19-20H2 |
| InChIKey | RONKNJLRQMOGCW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|