C20H22O4 — CID 23466030
4-hydroxy-4-methyl-6-[2-(4-phenoxyphenyl)ethyl]oxan-2-one (PubChem CID 23466030) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-6-[2-(4-phenoxyphenyl)ethyl]oxan-2-one.
| Compound Name | 4-hydroxy-4-methyl-6-[2-(4-phenoxyphenyl)ethyl]oxan-2-one |
|---|---|
| PubChem CID | 23466030 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-hydroxy-4-methyl-6-[2-(4-phenoxyphenyl)ethyl]oxan-2-one |
| SMILES | CC1(O)CC(=O)OC(CCc2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H22O4/c1-20(22)13-18(24-19(21)14-20)12-9-15-7-10-17(11-8-15)23-16-5-3-2-4-6-16/h2-8,10-11,18,22H,9,12-14H2,1H3 |
| InChIKey | NQEUSLHEDFQDMM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |